C10H12F2N2O2 — CID 81268570
4-(2,6-difluorophenoxy)butanehydrazide (PubChem CID 81268570) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is 4-(2,6-difluorophenoxy)butanehydrazide.
| Compound Name | 4-(2,6-difluorophenoxy)butanehydrazide |
|---|---|
| PubChem CID | 81268570 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 4-(2,6-difluorophenoxy)butanehydrazide |
| SMILES | NNC(=O)CCCOc1c(F)cccc1F |
| InChI | InChI=1S/C10H12F2N2O2/c11-7-3-1-4-8(12)10(7)16-6-2-5-9(15)14-13/h1,3-4H,2,5-6,13H2,(H,14,15) |
| InChIKey | GOBKAUOMKPVWPG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|