C11H11F5N2O2 — CID 63570877
5-(2,3,4,5,6-pentafluorophenoxy)pentanehydrazide (PubChem CID 63570877) has the molecular formula C11H11F5N2O2 and a molecular weight of 298.21 g/mol. Its IUPAC name is 5-(2,3,4,5,6-pentafluorophenoxy)pentanehydrazide.
| Compound Name | 5-(2,3,4,5,6-pentafluorophenoxy)pentanehydrazide |
|---|---|
| PubChem CID | 63570877 |
| Molecular Formula | C11H11F5N2O2 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 5-(2,3,4,5,6-pentafluorophenoxy)pentanehydrazide |
| SMILES | NNC(=O)CCCCOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H11F5N2O2/c12-6-7(13)9(15)11(10(16)8(6)14)20-4-2-1-3-5(19)18-17/h1-4,17H2,(H,18,19) |
| InChIKey | UGMJLKDDJOZPJJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|