C8H5F5N2O2 — CID 3248816
2-(2,3,4,5,6-pentafluorophenoxy)acetohydrazide (PubChem CID 3248816) has the molecular formula C8H5F5N2O2 and a molecular weight of 256.13 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenoxy)acetohydrazide.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 3248816 |
| Molecular Formula | C8H5F5N2O2 |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenoxy)acetohydrazide |
| SMILES | NNC(=O)COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H5F5N2O2/c9-3-4(10)6(12)8(7(13)5(3)11)17-1-2(16)15-14/h1,14H2,(H,15,16) |
| InChIKey | DIAULXZUNNOHLK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|