C8H7I3N2O2 — CID 63576981
2-(2,4,6-triiodophenoxy)acetohydrazide (PubChem CID 63576981) has the molecular formula C8H7I3N2O2 and a molecular weight of 543.87 g/mol. Its IUPAC name is 2-(2,4,6-triiodophenoxy)acetohydrazide.
| Compound Name | 2-(2,4,6-triiodophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 63576981 |
| Molecular Formula | C8H7I3N2O2 |
| Molecular Weight | 543.87 g/mol |
| Exact Mass | 543.76 |
| IUPAC Name | 2-(2,4,6-triiodophenoxy)acetohydrazide |
| SMILES | NNC(=O)COc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C8H7I3N2O2/c9-4-1-5(10)8(6(11)2-4)15-3-7(14)13-12/h1-2H,3,12H2,(H,13,14) |
| InChIKey | VLZWJHCRZBMZOF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.87 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|