C14H11I3N2O2 — CID 63574401
4-[(2,4,6-triiodophenoxy)methyl]benzohydrazide (PubChem CID 63574401) has the molecular formula C14H11I3N2O2 and a molecular weight of 619.97 g/mol. Its IUPAC name is 4-[(2,4,6-triiodophenoxy)methyl]benzohydrazide.
| Compound Name | 4-[(2,4,6-triiodophenoxy)methyl]benzohydrazide |
|---|---|
| PubChem CID | 63574401 |
| Molecular Formula | C14H11I3N2O2 |
| Molecular Weight | 619.97 g/mol |
| Exact Mass | 619.80 |
| IUPAC Name | 4-[(2,4,6-triiodophenoxy)methyl]benzohydrazide |
| SMILES | NNC(=O)c1ccc(COc2c(I)cc(I)cc2I)cc1 |
| InChI | InChI=1S/C14H11I3N2O2/c15-10-5-11(16)13(12(17)6-10)21-7-8-1-3-9(4-2-8)14(20)19-18/h1-6H,7,18H2,(H,19,20) |
| InChIKey | CUKOUPICLSAEAL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.97 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|