C13H9BrI3NO — CID 115557500
2-bromo-5-[(2,4,6-triiodophenoxy)methyl]aniline (PubChem CID 115557500) has the molecular formula C13H9BrI3NO and a molecular weight of 655.84 g/mol. Its IUPAC name is 2-bromo-5-[(2,4,6-triiodophenoxy)methyl]aniline.
| Compound Name | 2-bromo-5-[(2,4,6-triiodophenoxy)methyl]aniline |
|---|---|
| PubChem CID | 115557500 |
| Molecular Formula | C13H9BrI3NO |
| Molecular Weight | 655.84 g/mol |
| Exact Mass | 654.70 |
| IUPAC Name | 2-bromo-5-[(2,4,6-triiodophenoxy)methyl]aniline |
| SMILES | Nc1cc(COc2c(I)cc(I)cc2I)ccc1Br |
| InChI | InChI=1S/C13H9BrI3NO/c14-9-2-1-7(3-12(9)18)6-19-13-10(16)4-8(15)5-11(13)17/h1-5H,6,18H2 |
| InChIKey | CREIOQKMSKFUGA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.84 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|