C14H12Br3NO2 — CID 115557562
2-bromo-5-[(2,5-dibromo-4-methoxyphenoxy)methyl]aniline (PubChem CID 115557562) has the molecular formula C14H12Br3NO2 and a molecular weight of 465.97 g/mol. Its IUPAC name is 2-bromo-5-[(2,5-dibromo-4-methoxyphenoxy)methyl]aniline.
| Compound Name | 2-bromo-5-[(2,5-dibromo-4-methoxyphenoxy)methyl]aniline |
|---|---|
| PubChem CID | 115557562 |
| Molecular Formula | C14H12Br3NO2 |
| Molecular Weight | 465.97 g/mol |
| Exact Mass | 462.84 |
| IUPAC Name | 2-bromo-5-[(2,5-dibromo-4-methoxyphenoxy)methyl]aniline |
| SMILES | COc1cc(Br)c(OCc2ccc(Br)c(N)c2)cc1Br |
| InChI | InChI=1S/C14H12Br3NO2/c1-19-13-5-11(17)14(6-10(13)16)20-7-8-2-3-9(15)12(18)4-8/h2-6H,7,18H2,1H3 |
| InChIKey | DFRSSQPXWVZBLL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.97 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|