C13H10BrF2NO — CID 115557545
2-bromo-5-[(2,3-difluorophenoxy)methyl]aniline (PubChem CID 115557545) has the molecular formula C13H10BrF2NO and a molecular weight of 314.13 g/mol. Its IUPAC name is 2-bromo-5-[(2,3-difluorophenoxy)methyl]aniline.
| Compound Name | 2-bromo-5-[(2,3-difluorophenoxy)methyl]aniline |
|---|---|
| PubChem CID | 115557545 |
| Molecular Formula | C13H10BrF2NO |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 2-bromo-5-[(2,3-difluorophenoxy)methyl]aniline |
| SMILES | Nc1cc(COc2cccc(F)c2F)ccc1Br |
| InChI | InChI=1S/C13H10BrF2NO/c14-9-5-4-8(6-11(9)17)7-18-12-3-1-2-10(15)13(12)16/h1-6H,7,17H2 |
| InChIKey | NVJNRHWCFPYRLM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|