C13H10BF3O3 — CID 63036438
[5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid (PubChem CID 63036438) has the molecular formula C13H10BF3O3 and a molecular weight of 282.03 g/mol. Its IUPAC name is [5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid.
| Compound Name | [5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 63036438 |
| Molecular Formula | C13H10BF3O3 |
| Molecular Weight | 282.03 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | [5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid |
| SMILES | OB(O)c1cc(COc2cccc(F)c2F)ccc1F |
| InChI | InChI=1S/C13H10BF3O3/c15-10-5-4-8(6-9(10)14(18)19)7-20-12-3-1-2-11(16)13(12)17/h1-6,18-19H,7H2 |
| InChIKey | QKCJPBGWWBGQTL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.03 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|