[5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid

C13H10BF3O3 — CID 63036438

IUPAC[5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid
SMILESOB(O)c1cc(COc2cccc(F)c2F)ccc1F
InChIInChI=1S/C13H10BF3O3/c15-10-5-4-8(6-9(10)14(18)19)7-20-12-3-1-2-11(16)13(12)17/h1-6,18-19H,7H2
InChIKeyQKCJPBGWWBGQTL-UHFFFAOYSA-N
MW282.03 g/mol
LogP1.36
Rot. Bonds4

About [5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid

[5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid (PubChem CID 63036438) has the molecular formula C13H10BF3O3 and a molecular weight of 282.03 g/mol. Its IUPAC name is [5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid.

Molecular Properties

Compound Name[5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid
PubChem CID63036438
Molecular FormulaC13H10BF3O3
Molecular Weight282.03 g/mol
Exact Mass282.07
IUPAC Name[5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid
SMILESOB(O)c1cc(COc2cccc(F)c2F)ccc1F
InChIInChI=1S/C13H10BF3O3/c15-10-5-4-8(6-9(10)14(18)19)7-20-12-3-1-2-11(16)13(12)17/h1-6,18-19H,7H2
InChIKeyQKCJPBGWWBGQTL-UHFFFAOYSA-N
XLogP1.36
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.03
LogP ≤ 51.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid?
The IUPAC name of [5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid (CID 63036438) is [5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid.
What is the SMILES notation for [5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid?
The canonical SMILES for [5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid is OB(O)c1cc(COc2cccc(F)c2F)ccc1F.
What is the InChIKey of [5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid?
The InChIKey is QKCJPBGWWBGQTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BF3O3/c15-10-5-4-8(6-9(10)14(18)19)7-20-12-3-1-2-11(16)13(12)17/h1-6,18-19H,7H2.
What are the key properties of [5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid?
[5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid has a molecular weight of 282.03 g/mol, XLogP of 1.36, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2,3-difluorophenoxy)methyl]-2-fluorophenyl]boronic acid is sourced from PubChem (CID 63036438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).