C13H8BrF3O — CID 63457062
1-[(3-bromo-4-fluorophenyl)methoxy]-2,3-difluorobenzene (PubChem CID 63457062) has the molecular formula C13H8BrF3O and a molecular weight of 317.10 g/mol. Its IUPAC name is 1-[(3-bromo-4-fluorophenyl)methoxy]-2,3-difluorobenzene.
| Compound Name | 1-[(3-bromo-4-fluorophenyl)methoxy]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 63457062 |
| Molecular Formula | C13H8BrF3O |
| Molecular Weight | 317.10 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 1-[(3-bromo-4-fluorophenyl)methoxy]-2,3-difluorobenzene |
| SMILES | Fc1ccc(COc2cccc(F)c2F)cc1Br |
| InChI | InChI=1S/C13H8BrF3O/c14-9-6-8(4-5-10(9)15)7-18-12-3-1-2-11(16)13(12)17/h1-6H,7H2 |
| InChIKey | KIWBRZQNYFQJGQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.10 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |