C12H9F2NO — CID 141089252
4-[(2,3-difluorophenoxy)methyl]pyridine (PubChem CID 141089252) has the molecular formula C12H9F2NO and a molecular weight of 221.21 g/mol. Its IUPAC name is 4-[(2,3-difluorophenoxy)methyl]pyridine.
| Compound Name | 4-[(2,3-difluorophenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 141089252 |
| Molecular Formula | C12H9F2NO |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4-[(2,3-difluorophenoxy)methyl]pyridine |
| SMILES | Fc1cccc(OCc2ccncc2)c1F |
| InChI | InChI=1S/C12H9F2NO/c13-10-2-1-3-11(12(10)14)16-8-9-4-6-15-7-5-9/h1-7H,8H2 |
| InChIKey | SFRUCGRRXJNZQH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |