C12H5I6O4P — CID 102203170
bis(2,4,6-triiodophenyl) hydrogen phosphate (PubChem CID 102203170) has the molecular formula C12H5I6O4P and a molecular weight of 1005.57 g/mol. Its IUPAC name is bis(2,4,6-triiodophenyl) hydrogen phosphate.
| Compound Name | bis(2,4,6-triiodophenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 102203170 |
| Molecular Formula | C12H5I6O4P |
| Molecular Weight | 1005.57 g/mol |
| Exact Mass | 1005.42 |
| IUPAC Name | bis(2,4,6-triiodophenyl) hydrogen phosphate |
| SMILES | O=P(O)(Oc1c(I)cc(I)cc1I)Oc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C12H5I6O4P/c13-5-1-7(15)11(8(16)2-5)21-23(19,20)22-12-9(17)3-6(14)4-10(12)18/h1-4H,(H,19,20) |
| InChIKey | VDPNJRJXDOVRNQ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.57 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|