C12H12I2O6 — CID 11466266
methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate (PubChem CID 11466266) has the molecular formula C12H12I2O6 and a molecular weight of 506.03 g/mol. Its IUPAC name is methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate.
| Compound Name | methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate |
|---|---|
| PubChem CID | 11466266 |
| Molecular Formula | C12H12I2O6 |
| Molecular Weight | 506.03 g/mol |
| Exact Mass | 505.87 |
| IUPAC Name | methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate |
| SMILES | COC(=O)COc1cc(I)cc(I)c1OCC(=O)OC |
| InChI | InChI=1S/C12H12I2O6/c1-17-10(15)5-19-9-4-7(13)3-8(14)12(9)20-6-11(16)18-2/h3-4H,5-6H2,1-2H3 |
| InChIKey | AXTYXTBLUVDEBB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.03 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|