methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate

C12H12I2O6 — CID 11466266

IUPACmethyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate
SMILESCOC(=O)COc1cc(I)cc(I)c1OCC(=O)OC
InChIInChI=1S/C12H12I2O6/c1-17-10(15)5-19-9-4-7(13)3-8(14)12(9)20-6-11(16)18-2/h3-4H,5-6H2,1-2H3
InChIKeyAXTYXTBLUVDEBB-UHFFFAOYSA-N
MW506.03 g/mol
LogP2.00
Rot. Bonds6

About methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate

methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate (PubChem CID 11466266) has the molecular formula C12H12I2O6 and a molecular weight of 506.03 g/mol. Its IUPAC name is methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate.

Molecular Properties

Compound Namemethyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate
PubChem CID11466266
Molecular FormulaC12H12I2O6
Molecular Weight506.03 g/mol
Exact Mass505.87
IUPAC Namemethyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate
SMILESCOC(=O)COc1cc(I)cc(I)c1OCC(=O)OC
InChIInChI=1S/C12H12I2O6/c1-17-10(15)5-19-9-4-7(13)3-8(14)12(9)20-6-11(16)18-2/h3-4H,5-6H2,1-2H3
InChIKeyAXTYXTBLUVDEBB-UHFFFAOYSA-N
XLogP2.00
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500506.03
LogP ≤ 52.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate?
The IUPAC name of methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate (CID 11466266) is methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate.
What is the SMILES notation for methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate?
The canonical SMILES for methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate is COC(=O)COc1cc(I)cc(I)c1OCC(=O)OC.
What is the InChIKey of methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate?
The InChIKey is AXTYXTBLUVDEBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12I2O6/c1-17-10(15)5-19-9-4-7(13)3-8(14)12(9)20-6-11(16)18-2/h3-4H,5-6H2,1-2H3.
What are the key properties of methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate?
methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate has a molecular weight of 506.03 g/mol, XLogP of 2.00, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3,5-diiodo-2-(2-methoxy-2-oxoethoxy)phenoxy]acetate is sourced from PubChem (CID 11466266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).