C12H13IO4 — CID 167145356
methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate (PubChem CID 167145356) has the molecular formula C12H13IO4 and a molecular weight of 348.14 g/mol. Its IUPAC name is methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate.
| Compound Name | methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 167145356 |
| Molecular Formula | C12H13IO4 |
| Molecular Weight | 348.14 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate |
| SMILES | C=Cc1cc(I)c(OCC(=O)OC)c(OC)c1 |
| InChI | InChI=1S/C12H13IO4/c1-4-8-5-9(13)12(10(6-8)15-2)17-7-11(14)16-3/h4-6H,1,7H2,2-3H3 |
| InChIKey | FRWVYEJWFDWZCM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.14 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|