methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate

C12H13IO4 — CID 167145356

IUPACmethyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate
SMILESC=Cc1cc(I)c(OCC(=O)OC)c(OC)c1
InChIInChI=1S/C12H13IO4/c1-4-8-5-9(13)12(10(6-8)15-2)17-7-11(14)16-3/h4-6H,1,7H2,2-3H3
InChIKeyFRWVYEJWFDWZCM-UHFFFAOYSA-N
MW348.14 g/mol
LogP2.49
Rot. Bonds5

About methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate

methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate (PubChem CID 167145356) has the molecular formula C12H13IO4 and a molecular weight of 348.14 g/mol. Its IUPAC name is methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate.

Molecular Properties

Compound Namemethyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate
PubChem CID167145356
Molecular FormulaC12H13IO4
Molecular Weight348.14 g/mol
Exact Mass347.99
IUPAC Namemethyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate
SMILESC=Cc1cc(I)c(OCC(=O)OC)c(OC)c1
InChIInChI=1S/C12H13IO4/c1-4-8-5-9(13)12(10(6-8)15-2)17-7-11(14)16-3/h4-6H,1,7H2,2-3H3
InChIKeyFRWVYEJWFDWZCM-UHFFFAOYSA-N
XLogP2.49
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500348.14
LogP ≤ 52.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate?
The IUPAC name of methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate (CID 167145356) is methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate.
What is the SMILES notation for methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate?
The canonical SMILES for methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate is C=Cc1cc(I)c(OCC(=O)OC)c(OC)c1.
What is the InChIKey of methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate?
The InChIKey is FRWVYEJWFDWZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13IO4/c1-4-8-5-9(13)12(10(6-8)15-2)17-7-11(14)16-3/h4-6H,1,7H2,2-3H3.
What are the key properties of methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate?
methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate has a molecular weight of 348.14 g/mol, XLogP of 2.49, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-ethenyl-2-iodo-6-methoxyphenoxy)acetate is sourced from PubChem (CID 167145356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).