C20H22INO8S — CID 3918562
tert-butyl 2-[5-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 3918562) has the molecular formula C20H22INO8S and a molecular weight of 563.37 g/mol. Its IUPAC name is tert-butyl 2-[5-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[5-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 3918562 |
| Molecular Formula | C20H22INO8S |
| Molecular Weight | 563.37 g/mol |
| Exact Mass | 563.01 |
| IUPAC Name | tert-butyl 2-[5-[[3-iodo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COC(=O)COc1c(I)cc(C=C2SC(=O)N(CC(=O)OC(C)(C)C)C2=O)cc1OC |
| InChI | InChI=1S/C20H22INO8S/c1-20(2,3)30-15(23)9-22-18(25)14(31-19(22)26)8-11-6-12(21)17(13(7-11)27-4)29-10-16(24)28-5/h6-8H,9-10H2,1-5H3 |
| InChIKey | YPYBKPSNHYBCSO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|