C18H20ClNO6S — CID 73360786
tert-butyl 2-[5-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 73360786) has the molecular formula C18H20ClNO6S and a molecular weight of 413.88 g/mol. Its IUPAC name is tert-butyl 2-[5-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[5-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 73360786 |
| Molecular Formula | C18H20ClNO6S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | tert-butyl 2-[5-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COc1cc(C=C2SC(=O)N(CC(=O)OC(C)(C)C)C2=O)cc(Cl)c1OC |
| InChI | InChI=1S/C18H20ClNO6S/c1-18(2,3)26-14(21)9-20-16(22)13(27-17(20)23)8-10-6-11(19)15(25-5)12(7-10)24-4/h6-8H,9H2,1-5H3 |
| InChIKey | IVHNARLRMBSMDT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|