C25H26ClNO6S — CID 5115059
tert-butyl 2-[5-[[3-chloro-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 5115059) has the molecular formula C25H26ClNO6S and a molecular weight of 504.00 g/mol. Its IUPAC name is tert-butyl 2-[5-[[3-chloro-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[5-[[3-chloro-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 5115059 |
| Molecular Formula | C25H26ClNO6S |
| Molecular Weight | 504.00 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | tert-butyl 2-[5-[[3-chloro-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COc1cc(C=C2SC(=O)N(CC(=O)OC(C)(C)C)C2=O)cc(Cl)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C25H26ClNO6S/c1-15-7-6-8-16(9-15)14-32-22-18(26)10-17(11-19(22)31-5)12-20-23(29)27(24(30)34-20)13-21(28)33-25(2,3)4/h6-12H,13-14H2,1-5H3 |
| InChIKey | HXSTWRMOZBIVQB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.00 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|