C20H20BrNO6S — CID 3470945
tert-butyl 2-[5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 3470945) has the molecular formula C20H20BrNO6S and a molecular weight of 482.35 g/mol. Its IUPAC name is tert-butyl 2-[5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 3470945 |
| Molecular Formula | C20H20BrNO6S |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | tert-butyl 2-[5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | C#CCOc1c(Br)cc(C=C2SC(=O)N(CC(=O)OC(C)(C)C)C2=O)cc1OC |
| InChI | InChI=1S/C20H20BrNO6S/c1-6-7-27-17-13(21)8-12(9-14(17)26-5)10-15-18(24)22(19(25)29-15)11-16(23)28-20(2,3)4/h1,8-10H,7,11H2,2-5H3 |
| InChIKey | CZFWTMPEZZOXDG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|