C16H15BrINO5S — CID 3976760
tert-butyl 2-[5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 3976760) has the molecular formula C16H15BrINO5S and a molecular weight of 540.17 g/mol. Its IUPAC name is tert-butyl 2-[5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 3976760 |
| Molecular Formula | C16H15BrINO5S |
| Molecular Weight | 540.17 g/mol |
| Exact Mass | 538.89 |
| IUPAC Name | tert-butyl 2-[5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)SC(=Cc2cc(Br)c(O)c(I)c2)C1=O |
| InChI | InChI=1S/C16H15BrINO5S/c1-16(2,3)24-12(20)7-19-14(22)11(25-15(19)23)6-8-4-9(17)13(21)10(18)5-8/h4-6,21H,7H2,1-3H3 |
| InChIKey | ATKMXOAWXWNGFG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.17 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|