C13H11BrINO3S — CID 126241697
(5E)-5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-3-propyl-1,3-thiazolidine-2,4-dione (PubChem CID 126241697) has the molecular formula C13H11BrINO3S and a molecular weight of 468.11 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-3-propyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-3-propyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126241697 |
| Molecular Formula | C13H11BrINO3S |
| Molecular Weight | 468.11 g/mol |
| Exact Mass | 466.87 |
| IUPAC Name | (5E)-5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-3-propyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCCN1C(=O)S/C(=C/c2cc(Br)c(O)c(I)c2)C1=O |
| InChI | InChI=1S/C13H11BrINO3S/c1-2-3-16-12(18)10(20-13(16)19)6-7-4-8(14)11(17)9(15)5-7/h4-6,17H,2-3H2,1H3/b10-6+ |
| InChIKey | BUPAOHRJPYGMSM-UXBLZVDNSA-N |
| XLogP | 4.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.11 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|