C18H11I2NO4S — CID 126233370
(5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione (PubChem CID 126233370) has the molecular formula C18H11I2NO4S and a molecular weight of 591.16 g/mol. Its IUPAC name is (5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126233370 |
| Molecular Formula | C18H11I2NO4S |
| Molecular Weight | 591.16 g/mol |
| Exact Mass | 590.85 |
| IUPAC Name | (5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cc(I)c(O)c(I)c2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C18H11I2NO4S/c19-12-6-10(7-13(20)16(12)23)8-15-17(24)21(18(25)26-15)9-14(22)11-4-2-1-3-5-11/h1-8,23H,9H2/b15-8+ |
| InChIKey | SZEGSFLDTRTHSP-OVCLIPMQSA-N |
| XLogP | 4.52 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.16 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|