C23H20INO7S — CID 126225883
ethyl 2-[4-[(E)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 126225883) has the molecular formula C23H20INO7S and a molecular weight of 581.38 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126225883 |
| Molecular Formula | C23H20INO7S |
| Molecular Weight | 581.38 g/mol |
| Exact Mass | 581.00 |
| IUPAC Name | ethyl 2-[4-[(E)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2/SC(=O)N(CC(=O)c3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C23H20INO7S/c1-3-31-20(27)13-32-21-16(24)9-14(10-18(21)30-2)11-19-22(28)25(23(29)33-19)12-17(26)15-7-5-4-6-8-15/h4-11H,3,12-13H2,1-2H3/b19-11+ |
| InChIKey | PAIPGELQUQLEEQ-YBFXNURJSA-N |
| XLogP | 4.16 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|