C19H20INO6S — CID 126078482
ethyl 2-[4-[(E)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 126078482) has the molecular formula C19H20INO6S and a molecular weight of 517.34 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126078482 |
| Molecular Formula | C19H20INO6S |
| Molecular Weight | 517.34 g/mol |
| Exact Mass | 517.01 |
| IUPAC Name | ethyl 2-[4-[(E)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | C=CCN1C(=O)S/C(=C/c2cc(I)c(OCC(=O)OCC)c(OCC)c2)C1=O |
| InChI | InChI=1S/C19H20INO6S/c1-4-7-21-18(23)15(28-19(21)24)10-12-8-13(20)17(14(9-12)25-5-2)27-11-16(22)26-6-3/h4,8-10H,1,5-7,11H2,2-3H3/b15-10+ |
| InChIKey | BGQJHPKWXOYORV-XNTDXEJSSA-N |
| XLogP | 3.85 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|