C16H13I2NO5S — CID 126079610
methyl 2-[4-[(E)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2,6-diiodophenoxy]acetate (PubChem CID 126079610) has the molecular formula C16H13I2NO5S and a molecular weight of 585.16 g/mol. Its IUPAC name is methyl 2-[4-[(E)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2,6-diiodophenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2,6-diiodophenoxy]acetate |
|---|---|
| PubChem CID | 126079610 |
| Molecular Formula | C16H13I2NO5S |
| Molecular Weight | 585.16 g/mol |
| Exact Mass | 584.86 |
| IUPAC Name | methyl 2-[4-[(E)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2,6-diiodophenoxy]acetate |
| SMILES | C=CCN1C(=O)S/C(=C/c2cc(I)c(OCC(=O)OC)c(I)c2)C1=O |
| InChI | InChI=1S/C16H13I2NO5S/c1-3-4-19-15(21)12(25-16(19)22)7-9-5-10(17)14(11(18)6-9)24-8-13(20)23-2/h3,5-7H,1,4,8H2,2H3/b12-7+ |
| InChIKey | GHJSICNEZNDFLW-KPKJPENVSA-N |
| XLogP | 3.67 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.16 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|