C20H14I3NO3S — CID 126110430
(5E)-5-[[3,5-diiodo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione (PubChem CID 126110430) has the molecular formula C20H14I3NO3S and a molecular weight of 729.11 g/mol. Its IUPAC name is (5E)-5-[[3,5-diiodo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3,5-diiodo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126110430 |
| Molecular Formula | C20H14I3NO3S |
| Molecular Weight | 729.11 g/mol |
| Exact Mass | 728.78 |
| IUPAC Name | (5E)-5-[[3,5-diiodo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)S/C(=C/c2cc(I)c(OCc3ccc(I)cc3)c(I)c2)C1=O |
| InChI | InChI=1S/C20H14I3NO3S/c1-2-7-24-19(25)17(28-20(24)26)10-13-8-15(22)18(16(23)9-13)27-11-12-3-5-14(21)6-4-12/h2-6,8-10H,1,7,11H2/b17-10+ |
| InChIKey | DLJULYBRYLICHR-LICLKQGHSA-N |
| XLogP | 6.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.11 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|