C16H15I2NO3S — CID 126249894
(5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-3-propyl-1,3-thiazolidine-2,4-dione (PubChem CID 126249894) has the molecular formula C16H15I2NO3S and a molecular weight of 555.18 g/mol. Its IUPAC name is (5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-3-propyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-3-propyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126249894 |
| Molecular Formula | C16H15I2NO3S |
| Molecular Weight | 555.18 g/mol |
| Exact Mass | 554.89 |
| IUPAC Name | (5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-3-propyl-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCOc1c(I)cc(/C=C2/SC(=O)N(CCC)C2=O)cc1I |
| InChI | InChI=1S/C16H15I2NO3S/c1-3-5-19-15(20)13(23-16(19)21)9-10-7-11(17)14(12(18)8-10)22-6-4-2/h4,7-9H,2-3,5-6H2,1H3/b13-9+ |
| InChIKey | ZSDMWEGARKZQPV-UKTHLTGXSA-N |
| XLogP | 4.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.18 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|