C15H13I2NO2S2 — CID 126387951
(5Z)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126387951) has the molecular formula C15H13I2NO2S2 and a molecular weight of 557.22 g/mol. Its IUPAC name is (5Z)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126387951 |
| Molecular Formula | C15H13I2NO2S2 |
| Molecular Weight | 557.22 g/mol |
| Exact Mass | 556.85 |
| IUPAC Name | (5Z)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1c(I)cc(/C=C2\SC(=S)N(CC)C2=O)cc1I |
| InChI | InChI=1S/C15H13I2NO2S2/c1-3-5-20-13-10(16)6-9(7-11(13)17)8-12-14(19)18(4-2)15(21)22-12/h3,6-8H,1,4-5H2,2H3/b12-8- |
| InChIKey | XAOUMWLOLDEYKF-WQLSENKSSA-N |
| XLogP | 4.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.22 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|