C17H18BrNO4S — CID 126073511
(5E)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione (PubChem CID 126073511) has the molecular formula C17H18BrNO4S and a molecular weight of 412.31 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126073511 |
| Molecular Formula | C17H18BrNO4S |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | (5E)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)S/C(=C/c2cc(Br)c(OCC)c(OCC)c2)C1=O |
| InChI | InChI=1S/C17H18BrNO4S/c1-4-7-19-16(20)14(24-17(19)21)10-11-8-12(18)15(23-6-3)13(9-11)22-5-2/h4,8-10H,1,5-7H2,2-3H3/b14-10+ |
| InChIKey | BPNLWNWZYNYCHM-GXDHUFHOSA-N |
| XLogP | 4.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|