C23H21ClINO6S — CID 126251122
ethyl 2-[4-[(E)-[3-[(4-chlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 126251122) has the molecular formula C23H21ClINO6S and a molecular weight of 601.85 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-[3-[(4-chlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-[3-[(4-chlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126251122 |
| Molecular Formula | C23H21ClINO6S |
| Molecular Weight | 601.85 g/mol |
| Exact Mass | 600.98 |
| IUPAC Name | ethyl 2-[4-[(E)-[3-[(4-chlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2/SC(=O)N(Cc3ccc(Cl)cc3)C2=O)cc1OCC |
| InChI | InChI=1S/C23H21ClINO6S/c1-3-30-18-10-15(9-17(25)21(18)32-13-20(27)31-4-2)11-19-22(28)26(23(29)33-19)12-14-5-7-16(24)8-6-14/h5-11H,3-4,12-13H2,1-2H3/b19-11+ |
| InChIKey | KWRVLWCEGWRNQM-YBFXNURJSA-N |
| XLogP | 5.52 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.85 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|