C22H19ClINO5S — CID 126275273
(5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126275273) has the molecular formula C22H19ClINO5S and a molecular weight of 571.82 g/mol. Its IUPAC name is (5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126275273 |
| Molecular Formula | C22H19ClINO5S |
| Molecular Weight | 571.82 g/mol |
| Exact Mass | 570.97 |
| IUPAC Name | (5E)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)c3ccc(Cl)cc3)C2=O)cc(I)c1OCC |
| InChI | InChI=1S/C22H19ClINO5S/c1-3-29-18-10-13(9-16(24)20(18)30-4-2)11-19-21(27)25(22(28)31-19)12-17(26)14-5-7-15(23)8-6-14/h5-11H,3-4,12H2,1-2H3/b19-11+ |
| InChIKey | FGLVZZQSTDYDOJ-YBFXNURJSA-N |
| XLogP | 5.66 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.82 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|