C15H14INO6S — CID 126148133
2-[(5E)-5-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 126148133) has the molecular formula C15H14INO6S and a molecular weight of 463.25 g/mol. Its IUPAC name is 2-[(5E)-5-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 126148133 |
| Molecular Formula | C15H14INO6S |
| Molecular Weight | 463.25 g/mol |
| Exact Mass | 462.96 |
| IUPAC Name | 2-[(5E)-5-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)O)C2=O)cc(I)c1OC |
| InChI | InChI=1S/C15H14INO6S/c1-3-23-10-5-8(4-9(16)13(10)22-2)6-11-14(20)17(7-12(18)19)15(21)24-11/h4-6H,3,7H2,1-2H3,(H,18,19)/b11-6+ |
| InChIKey | WYONPKQIZVDTCS-IZZDOVSWSA-N |
| XLogP | 2.82 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|