C26H18Cl2INO5S — CID 126253692
(5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126253692) has the molecular formula C26H18Cl2INO5S and a molecular weight of 654.31 g/mol. Its IUPAC name is (5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126253692 |
| Molecular Formula | C26H18Cl2INO5S |
| Molecular Weight | 654.31 g/mol |
| Exact Mass | 652.93 |
| IUPAC Name | (5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)c3ccc(Cl)cc3)C2=O)cc(I)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H18Cl2INO5S/c1-34-22-11-15(10-20(29)24(22)35-14-17-4-2-3-5-19(17)28)12-23-25(32)30(26(33)36-23)13-21(31)16-6-8-18(27)9-7-16/h2-12H,13-14H2,1H3/b23-12+ |
| InChIKey | CSZSDXDFEPPNPX-FSJBWODESA-N |
| XLogP | 7.10 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.31 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|