C17H16BrNO5S — CID 126071487
ethyl 2-[2-bromo-4-[(E)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate (PubChem CID 126071487) has the molecular formula C17H16BrNO5S and a molecular weight of 426.29 g/mol. Its IUPAC name is ethyl 2-[2-bromo-4-[(E)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-4-[(E)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126071487 |
| Molecular Formula | C17H16BrNO5S |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | ethyl 2-[2-bromo-4-[(E)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
| SMILES | C=CCN1C(=O)S/C(=C/c2ccc(OCC(=O)OCC)c(Br)c2)C1=O |
| InChI | InChI=1S/C17H16BrNO5S/c1-3-7-19-16(21)14(25-17(19)22)9-11-5-6-13(12(18)8-11)24-10-15(20)23-4-2/h3,5-6,8-9H,1,4,7,10H2,2H3/b14-9+ |
| InChIKey | GDVYOKKTNDYUPG-NTEUORMPSA-N |
| XLogP | 3.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|