C15H12BrNO7S — CID 2177902
2-[2-bromo-4-[(Z)-[3-(2-methoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 2177902) has the molecular formula C15H12BrNO7S and a molecular weight of 430.23 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-[3-(2-methoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[(Z)-[3-(2-methoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 2177902 |
| Molecular Formula | C15H12BrNO7S |
| Molecular Weight | 430.23 g/mol |
| Exact Mass | 428.95 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-[3-(2-methoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COC(=O)CN1C(=O)S/C(=C\c2ccc(OCC(=O)O)c(Br)c2)C1=O |
| InChI | InChI=1S/C15H12BrNO7S/c1-23-13(20)6-17-14(21)11(25-15(17)22)5-8-2-3-10(9(16)4-8)24-7-12(18)19/h2-5H,6-7H2,1H3,(H,18,19)/b11-5- |
| InChIKey | PHZODOPESZAJLM-WZUFQYTHSA-N |
| XLogP | 2.12 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|