C21H18BrNO5S — CID 126218696
methyl 2-[2-bromo-4-[(E)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126218696) has the molecular formula C21H18BrNO5S and a molecular weight of 476.35 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[(E)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[(E)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126218696 |
| Molecular Formula | C21H18BrNO5S |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | methyl 2-[2-bromo-4-[(E)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=C2/SC(=O)N(CCc3ccccc3)C2=O)cc1Br |
| InChI | InChI=1S/C21H18BrNO5S/c1-27-19(24)13-28-17-8-7-15(11-16(17)22)12-18-20(25)23(21(26)29-18)10-9-14-5-3-2-4-6-14/h2-8,11-12H,9-10,13H2,1H3/b18-12+ |
| InChIKey | MRTQOZPHHLGTRN-LDADJPATSA-N |
| XLogP | 4.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|