C21H18INO5S — CID 126136023
2-[4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetic acid (PubChem CID 126136023) has the molecular formula C21H18INO5S and a molecular weight of 523.35 g/mol. Its IUPAC name is 2-[4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetic acid |
|---|---|
| PubChem CID | 126136023 |
| Molecular Formula | C21H18INO5S |
| Molecular Weight | 523.35 g/mol |
| Exact Mass | 523.00 |
| IUPAC Name | 2-[4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=C2/SC(=O)N(CCCc3ccccc3)C2=O)cc1I |
| InChI | InChI=1S/C21H18INO5S/c22-16-11-15(8-9-17(16)28-13-19(24)25)12-18-20(26)23(21(27)29-18)10-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-9,11-12H,4,7,10,13H2,(H,24,25)/b18-12+ |
| InChIKey | SEUDBOVDMQGXAL-LDADJPATSA-N |
| XLogP | 4.42 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|