C26H21FINO3S — CID 126140404
(5E)-5-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126140404) has the molecular formula C26H21FINO3S and a molecular weight of 573.43 g/mol. Its IUPAC name is (5E)-5-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126140404 |
| Molecular Formula | C26H21FINO3S |
| Molecular Weight | 573.43 g/mol |
| Exact Mass | 573.03 |
| IUPAC Name | (5E)-5-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(OCc3cccc(F)c3)c(I)c2)C(=O)N1CCCc1ccccc1 |
| InChI | InChI=1S/C26H21FINO3S/c27-21-10-4-8-20(14-21)17-32-23-12-11-19(15-22(23)28)16-24-25(30)29(26(31)33-24)13-5-9-18-6-2-1-3-7-18/h1-4,6-8,10-12,14-16H,5,9,13,17H2/b24-16+ |
| InChIKey | OXKKORITYWNVKY-LFVJCYFKSA-N |
| XLogP | 6.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.43 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|