C22H21ClFNO3S — CID 126205607
(5Z)-5-[[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione (PubChem CID 126205607) has the molecular formula C22H21ClFNO3S and a molecular weight of 433.93 g/mol. Its IUPAC name is (5Z)-5-[[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126205607 |
| Molecular Formula | C22H21ClFNO3S |
| Molecular Weight | 433.93 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | (5Z)-5-[[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCCN1C(=O)S/C(=C\c2ccc(OCc3cccc(F)c3)c(Cl)c2)C1=O |
| InChI | InChI=1S/C22H21ClFNO3S/c1-2-3-4-10-25-21(26)20(29-22(25)27)13-15-8-9-19(18(23)12-15)28-14-16-6-5-7-17(24)11-16/h5-9,11-13H,2-4,10,14H2,1H3/b20-13- |
| InChIKey | BZWDZKHZEPSZPE-MOSHPQCFSA-N |
| XLogP | 6.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.93 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|