C21H19ClINO3S — CID 126060749
(5Z)-3-butyl-5-[[3-chloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126060749) has the molecular formula C21H19ClINO3S and a molecular weight of 527.81 g/mol. Its IUPAC name is (5Z)-3-butyl-5-[[3-chloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-butyl-5-[[3-chloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126060749 |
| Molecular Formula | C21H19ClINO3S |
| Molecular Weight | 527.81 g/mol |
| Exact Mass | 526.98 |
| IUPAC Name | (5Z)-3-butyl-5-[[3-chloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCN1C(=O)S/C(=C\c2ccc(OCc3ccc(I)cc3)c(Cl)c2)C1=O |
| InChI | InChI=1S/C21H19ClINO3S/c1-2-3-10-24-20(25)19(28-21(24)26)12-15-6-9-18(17(22)11-15)27-13-14-4-7-16(23)8-5-14/h4-9,11-12H,2-3,10,13H2,1H3/b19-12- |
| InChIKey | JCISTLPVMQMYHJ-UNOMPAQXSA-N |
| XLogP | 6.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.81 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|