C21H20N2O4S — CID 126134572
2-[4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126134572) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is 2-[4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | 2-[4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126134572 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-[4-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(/C=C2/SC(=O)N(CCCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C21H20N2O4S/c22-19(24)14-27-17-10-8-16(9-11-17)13-18-20(25)23(21(26)28-18)12-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-11,13H,4,7,12,14H2,(H2,22,24)/b18-13+ |
| InChIKey | FCJSMDBKEWDSNT-QGOAFFKASA-N |
| XLogP | 3.22 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|