C27H22BrNO4S — CID 137424500
(5Z)-3-(3-bromopropyl)-5-[[4-[2-oxo-2-(4-phenylphenyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 137424500) has the molecular formula C27H22BrNO4S and a molecular weight of 536.45 g/mol. Its IUPAC name is (5Z)-3-(3-bromopropyl)-5-[[4-[2-oxo-2-(4-phenylphenyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(3-bromopropyl)-5-[[4-[2-oxo-2-(4-phenylphenyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 137424500 |
| Molecular Formula | C27H22BrNO4S |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | (5Z)-3-(3-bromopropyl)-5-[[4-[2-oxo-2-(4-phenylphenyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(COc1ccc(/C=C2\SC(=O)N(CCCBr)C2=O)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H22BrNO4S/c28-15-4-16-29-26(31)25(34-27(29)32)17-19-7-13-23(14-8-19)33-18-24(30)22-11-9-21(10-12-22)20-5-2-1-3-6-20/h1-3,5-14,17H,4,15-16,18H2/b25-17- |
| InChIKey | WTZPTZQEDSNTMY-UQQQWYQISA-N |
| XLogP | 6.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|