C15H14INO5S — CID 126024477
2-[4-[(E)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-2-iodophenoxy]acetic acid (PubChem CID 126024477) has the molecular formula C15H14INO5S and a molecular weight of 447.25 g/mol. Its IUPAC name is 2-[4-[(E)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-2-iodophenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-2-iodophenoxy]acetic acid |
|---|---|
| PubChem CID | 126024477 |
| Molecular Formula | C15H14INO5S |
| Molecular Weight | 447.25 g/mol |
| Exact Mass | 446.96 |
| IUPAC Name | 2-[4-[(E)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-2-iodophenoxy]acetic acid |
| SMILES | CC(C)N1C(=O)S/C(=C/c2ccc(OCC(=O)O)c(I)c2)C1=O |
| InChI | InChI=1S/C15H14INO5S/c1-8(2)17-14(20)12(23-15(17)21)6-9-3-4-11(10(16)5-9)22-7-13(18)19/h3-6,8H,7H2,1-2H3,(H,18,19)/b12-6+ |
| InChIKey | IQLPRKXFHQHVSF-WUXMJOGZSA-N |
| XLogP | 3.20 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|