C17H16BrNO8S — CID 1235625
methyl 2-[(5E)-5-[[3-bromo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 1235625) has the molecular formula C17H16BrNO8S and a molecular weight of 474.29 g/mol. Its IUPAC name is methyl 2-[(5E)-5-[[3-bromo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | methyl 2-[(5E)-5-[[3-bromo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 1235625 |
| Molecular Formula | C17H16BrNO8S |
| Molecular Weight | 474.29 g/mol |
| Exact Mass | 472.98 |
| IUPAC Name | methyl 2-[(5E)-5-[[3-bromo-5-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COC(=O)COc1c(Br)cc(/C=C2/SC(=O)N(CC(=O)OC)C2=O)cc1OC |
| InChI | InChI=1S/C17H16BrNO8S/c1-24-11-5-9(4-10(18)15(11)27-8-14(21)26-3)6-12-16(22)19(17(23)28-12)7-13(20)25-2/h4-6H,7-8H2,1-3H3/b12-6+ |
| InChIKey | MLYIECKGBYFGNP-WUXMJOGZSA-N |
| XLogP | 2.22 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|