C20H15Br2NO3S — CID 126106283
(5E)-5-[[3-bromo-4-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione (PubChem CID 126106283) has the molecular formula C20H15Br2NO3S and a molecular weight of 509.22 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-bromo-4-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126106283 |
| Molecular Formula | C20H15Br2NO3S |
| Molecular Weight | 509.22 g/mol |
| Exact Mass | 506.91 |
| IUPAC Name | (5E)-5-[[3-bromo-4-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)S/C(=C/c2ccc(OCc3ccc(Br)cc3)c(Br)c2)C1=O |
| InChI | InChI=1S/C20H15Br2NO3S/c1-2-9-23-19(24)18(27-20(23)25)11-14-5-8-17(16(22)10-14)26-12-13-3-6-15(21)7-4-13/h2-8,10-11H,1,9,12H2/b18-11+ |
| InChIKey | RYDSLTCNHLFGTB-WOJGMQOQSA-N |
| XLogP | 6.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.22 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|