C20H15IN2O5S — CID 126078968
(5E)-5-[[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione (PubChem CID 126078968) has the molecular formula C20H15IN2O5S and a molecular weight of 522.32 g/mol. Its IUPAC name is (5E)-5-[[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126078968 |
| Molecular Formula | C20H15IN2O5S |
| Molecular Weight | 522.32 g/mol |
| Exact Mass | 521.97 |
| IUPAC Name | (5E)-5-[[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)S/C(=C/c2ccc(OCc3ccc([N+](=O)[O-])cc3)c(I)c2)C1=O |
| InChI | InChI=1S/C20H15IN2O5S/c1-2-9-22-19(24)18(29-20(22)25)11-14-5-8-17(16(21)10-14)28-12-13-3-6-15(7-4-13)23(26)27/h2-8,10-11H,1,9,12H2/b18-11+ |
| InChIKey | WFGYZOBAAJLIRQ-WOJGMQOQSA-N |
| XLogP | 5.00 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.32 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|