C23H21NO6S — CID 1210431
4-[[4-[(Z)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 1210431) has the molecular formula C23H21NO6S and a molecular weight of 439.49 g/mol. Its IUPAC name is 4-[[4-[(Z)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(Z)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 1210431 |
| Molecular Formula | C23H21NO6S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 4-[[4-[(Z)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | C=CCN1C(=O)S/C(=C\c2ccc(OCc3ccc(C(=O)O)cc3)c(OCC)c2)C1=O |
| InChI | InChI=1S/C23H21NO6S/c1-3-11-24-21(25)20(31-23(24)28)13-16-7-10-18(19(12-16)29-4-2)30-14-15-5-8-17(9-6-15)22(26)27/h3,5-10,12-13H,1,4,11,14H2,2H3,(H,26,27)/b20-13- |
| InChIKey | VBGKMONDAFZWEV-MOSHPQCFSA-N |
| XLogP | 4.58 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|