C17H17NO6S — CID 6026636
2-[4-[(Z)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxyphenoxy]acetic acid (PubChem CID 6026636) has the molecular formula C17H17NO6S and a molecular weight of 363.39 g/mol. Its IUPAC name is 2-[4-[(Z)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 6026636 |
| Molecular Formula | C17H17NO6S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-[4-[(Z)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxyphenoxy]acetic acid |
| SMILES | C=CCN1C(=O)S/C(=C\c2ccc(OCC(=O)O)c(OCC)c2)C1=O |
| InChI | InChI=1S/C17H17NO6S/c1-3-7-18-16(21)14(25-17(18)22)9-11-5-6-12(24-10-15(19)20)13(8-11)23-4-2/h3,5-6,8-9H,1,4,7,10H2,2H3,(H,19,20)/b14-9- |
| InChIKey | CMMXTGQPMSAKBZ-ZROIWOOFSA-N |
| XLogP | 2.77 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|