C23H23NO4S — CID 126014634
(5Z)-5-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126014634) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is (5Z)-5-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126014634 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (5Z)-5-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCOc1ccc(/C=C2\SC(=O)N(CCc3ccccc3)C2=O)cc1OCC |
| InChI | InChI=1S/C23H23NO4S/c1-3-14-28-19-11-10-18(15-20(19)27-4-2)16-21-22(25)24(23(26)29-21)13-12-17-8-6-5-7-9-17/h3,5-11,15-16H,1,4,12-14H2,2H3/b21-16- |
| InChIKey | VBDBYIDEPLCDMZ-PGMHBOJBSA-N |
| XLogP | 4.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|