C22H20BrNO4S — CID 124667358
(5E)-3-[(2-bromophenyl)methyl]-5-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124667358) has the molecular formula C22H20BrNO4S and a molecular weight of 474.38 g/mol. Its IUPAC name is (5E)-3-[(2-bromophenyl)methyl]-5-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-bromophenyl)methyl]-5-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124667358 |
| Molecular Formula | C22H20BrNO4S |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | (5E)-3-[(2-bromophenyl)methyl]-5-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCOc1ccc(/C=C2/SC(=O)N(Cc3ccccc3Br)C2=O)cc1OCC |
| InChI | InChI=1S/C22H20BrNO4S/c1-3-11-28-18-10-9-15(12-19(18)27-4-2)13-20-21(25)24(22(26)29-20)14-16-7-5-6-8-17(16)23/h3,5-10,12-13H,1,4,11,14H2,2H3/b20-13+ |
| InChIKey | BAPYPEDOOGVXOB-DEDYPNTBSA-N |
| XLogP | 5.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|