C26H22BrNO4S — CID 124667391
(5E)-3-[(2-bromophenyl)methyl]-5-[(3-ethoxy-4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124667391) has the molecular formula C26H22BrNO4S and a molecular weight of 524.44 g/mol. Its IUPAC name is (5E)-3-[(2-bromophenyl)methyl]-5-[(3-ethoxy-4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-bromophenyl)methyl]-5-[(3-ethoxy-4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124667391 |
| Molecular Formula | C26H22BrNO4S |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | (5E)-3-[(2-bromophenyl)methyl]-5-[(3-ethoxy-4-phenylmethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(Cc3ccccc3Br)C2=O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H22BrNO4S/c1-2-31-23-14-19(12-13-22(23)32-17-18-8-4-3-5-9-18)15-24-25(29)28(26(30)33-24)16-20-10-6-7-11-21(20)27/h3-15H,2,16-17H2,1H3/b24-15+ |
| InChIKey | KLLNBWFBZSXNRV-BUVRLJJBSA-N |
| XLogP | 6.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|